C17H18N2O3S — CID 119217558
2-[1-[[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]amino]cyclobutyl]acetic acid (PubChem CID 119217558) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[1-[[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119217558 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[1-[[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)Cc2csc(-c3ccccc3)n2)CCC1 |
| InChI | InChI=1S/C17H18N2O3S/c20-14(19-17(7-4-8-17)10-15(21)22)9-13-11-23-16(18-13)12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H,19,20)(H,21,22) |
| InChIKey | YAWSCIBNBBVUHT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |