C13H16F3N7O3 — CID 119219825
6-[[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazole-3-carbonyl]amino]hexanoic acid (PubChem CID 119219825) has the molecular formula C13H16F3N7O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is 6-[[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazole-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazole-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219825 |
| Molecular Formula | C13H16F3N7O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-[[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazole-3-carbonyl]amino]hexanoic acid |
| SMILES | Cc1nc(C(=O)NCCCCCC(=O)O)nn1-c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F3N7O3/c1-7-18-9(10(26)17-6-4-2-3-5-8(24)25)22-23(7)12-19-11(20-21-12)13(14,15)16/h2-6H2,1H3,(H,17,26)(H,24,25)(H,19,20,21) |
| InChIKey | IWRQCOXBFYJUNT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|