C18H24N4O3 — CID 119234576
5-[[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]amino]pentanoic acid (PubChem CID 119234576) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-[[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234576 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-[[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1nc(C(=O)NCCCCC(=O)O)nn1-c1ccccc1C(C)C |
| InChI | InChI=1S/C18H24N4O3/c1-12(2)14-8-4-5-9-15(14)22-13(3)20-17(21-22)18(25)19-11-7-6-10-16(23)24/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H,19,25)(H,23,24) |
| InChIKey | OMCKELBXDLPBKQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|