C20H25N3O3 — CID 119219866
6-[[1-(2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]hexanoic acid (PubChem CID 119219866) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-[[1-(2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-(2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219866 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 6-[[1-(2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]hexanoic acid |
| SMILES | Cc1ccccc1-n1nc(C(=O)NCCCCCC(=O)O)c2c1CCC2 |
| InChI | InChI=1S/C20H25N3O3/c1-14-8-4-5-10-16(14)23-17-11-7-9-15(17)19(22-23)20(26)21-13-6-2-3-12-18(24)25/h4-5,8,10H,2-3,6-7,9,11-13H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | MIZPTZDWVHTBQL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|