C19H22FN3O3 — CID 122107817
5-[[1-(2-fluoro-5-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]pentanoic acid (PubChem CID 122107817) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 5-[[1-(2-fluoro-5-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(2-fluoro-5-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122107817 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-[[1-(2-fluoro-5-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(F)c(-n2nc(C(=O)NCCCCC(=O)O)c3c2CCC3)c1 |
| InChI | InChI=1S/C19H22FN3O3/c1-12-8-9-14(20)16(11-12)23-15-6-4-5-13(15)18(22-23)19(26)21-10-3-2-7-17(24)25/h8-9,11H,2-7,10H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | OCCHPOPIQJIZDL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|