C18H18F3N3O3 — CID 119220762
3-[[5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]butanoic acid (PubChem CID 119220762) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 3-[[5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119220762 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-[[5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C1CC1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-10(7-15(25)26)23-17(27)14-9-22-24(16(14)11-5-6-11)13-4-2-3-12(8-13)18(19,20)21/h2-4,8-11H,5-7H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | SAGJVXHSOXDDHT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |