C16H18Cl2N2O4 — CID 119221005
3-[[1-(3,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 119221005) has the molecular formula C16H18Cl2N2O4 and a molecular weight of 373.24 g/mol. Its IUPAC name is 3-[[1-(3,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[1-(3,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119221005 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-[[1-(3,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-9(5-14(21)22)19-15(23)13-3-2-4-20(13)16(24)10-6-11(17)8-12(18)7-10/h6-9,13H,2-5H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | XLTSURRGZQLVCL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |