C16H21Cl2N3O2 — CID 119429601
1-(3,5-dichlorobenzoyl)-N-[3-(methylamino)propyl]pyrrolidine-2-carboxamide (PubChem CID 119429601) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-(3,5-dichlorobenzoyl)-N-[3-(methylamino)propyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(3,5-dichlorobenzoyl)-N-[3-(methylamino)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119429601 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-(3,5-dichlorobenzoyl)-N-[3-(methylamino)propyl]pyrrolidine-2-carboxamide |
| SMILES | CNCCCNC(=O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-19-5-3-6-20-15(22)14-4-2-7-21(14)16(23)11-8-12(17)10-13(18)9-11/h8-10,14,19H,2-7H2,1H3,(H,20,22) |
| InChIKey | INCCKVJNELUTQV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|