C17H19Cl2F3N2O3 — CID 78862017
1-(3,5-dichlorobenzoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxamide (PubChem CID 78862017) has the molecular formula C17H19Cl2F3N2O3 and a molecular weight of 427.25 g/mol. Its IUPAC name is 1-(3,5-dichlorobenzoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(3,5-dichlorobenzoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78862017 |
| Molecular Formula | C17H19Cl2F3N2O3 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-(3,5-dichlorobenzoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCOCC(F)(F)F)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2F3N2O3/c18-12-7-11(8-13(19)9-12)16(26)24-5-1-3-14(24)15(25)23-4-2-6-27-10-17(20,21)22/h7-9,14H,1-6,10H2,(H,23,25) |
| InChIKey | QBXSFHMSALEZBB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|