C20H25N2O5S- — CID 11922503
(1S,6R)-6-[[4-ethyl-5-methyl-3-(morpholine-4-carbonyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 11922503) has the molecular formula C20H25N2O5S- and a molecular weight of 405.50 g/mol. Its IUPAC name is (1S,6R)-6-[[4-ethyl-5-methyl-3-(morpholine-4-carbonyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[[4-ethyl-5-methyl-3-(morpholine-4-carbonyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11922503 |
| Molecular Formula | C20H25N2O5S- |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (1S,6R)-6-[[4-ethyl-5-methyl-3-(morpholine-4-carbonyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCc1c(C)sc(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)[O-])c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H26N2O5S/c1-3-13-12(2)28-18(16(13)19(24)22-8-10-27-11-9-22)21-17(23)14-6-4-5-7-15(14)20(25)26/h4-5,14-15H,3,6-11H2,1-2H3,(H,21,23)(H,25,26)/p-1/t14-,15+/m1/s1 |
| InChIKey | QYPOMAQEIRGJFI-CABCVRRESA-M |
| XLogP | 1.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|