C10H11N5O4 — CID 119226184
2-methyl-5-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]furan-3-carboxylic acid (PubChem CID 119226184) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-methyl-5-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119226184 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-methyl-5-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)Cn2cnnn2)cc1C(=O)O |
| InChI | InChI=1S/C10H11N5O4/c1-6-8(10(17)18)2-7(19-6)3-11-9(16)4-15-5-12-13-14-15/h2,5H,3-4H2,1H3,(H,11,16)(H,17,18) |
| InChIKey | DJZOVNDPLSSVBL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |