C17H19NO6 — CID 119226219
2-methyl-5-[[[2-(2-phenoxyethoxy)acetyl]amino]methyl]furan-3-carboxylic acid (PubChem CID 119226219) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-methyl-5-[[[2-(2-phenoxyethoxy)acetyl]amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[[2-(2-phenoxyethoxy)acetyl]amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119226219 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-methyl-5-[[[2-(2-phenoxyethoxy)acetyl]amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)COCCOc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C17H19NO6/c1-12-15(17(20)21)9-14(24-12)10-18-16(19)11-22-7-8-23-13-5-3-2-4-6-13/h2-6,9H,7-8,10-11H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ULPXZMZZIXHAJN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|