C17H23N3O5S — CID 119226234
5-[[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119226234) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 5-[[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119226234 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 5-[[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1C(=O)O |
| InChI | InChI=1S/C17H23N3O5S/c1-9-11(16(22)23)6-10(25-9)7-18-14(21)5-3-2-4-13-15-12(8-26-13)19-17(24)20-15/h6,12-13,15H,2-5,7-8H2,1H3,(H,18,21)(H,22,23)(H2,19,20,24)/t12-,13-,15-/m0/s1 |
| InChIKey | GERCNISVAAPJCX-YDHLFZDLSA-N |
| XLogP | 1.63 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|