C19H25NO5 — CID 119227407
7-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropanecarbonyl]amino]heptanoic acid (PubChem CID 119227407) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 7-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropanecarbonyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropanecarbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 119227407 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 7-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropanecarbonyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C1CC1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H25NO5/c21-18(22)5-3-1-2-4-8-20-19(23)15-12-14(15)13-6-7-16-17(11-13)25-10-9-24-16/h6-7,11,14-15H,1-5,8-10,12H2,(H,20,23)(H,21,22) |
| InChIKey | WJRGXFQQSRWZAD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|