C17H22BrNO3 — CID 119227195
7-[[2-(3-bromophenyl)cyclopropanecarbonyl]amino]heptanoic acid (PubChem CID 119227195) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is 7-[[2-(3-bromophenyl)cyclopropanecarbonyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(3-bromophenyl)cyclopropanecarbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 119227195 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 7-[[2-(3-bromophenyl)cyclopropanecarbonyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C1CC1c1cccc(Br)c1 |
| InChI | InChI=1S/C17H22BrNO3/c18-13-7-5-6-12(10-13)14-11-15(14)17(22)19-9-4-2-1-3-8-16(20)21/h5-7,10,14-15H,1-4,8-9,11H2,(H,19,22)(H,20,21) |
| InChIKey | VIOGMPZPYYYKKT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|