C16H21NO3 — CID 99849422
5-[[(1S,2S)-2-(2-methylphenyl)cyclopropanecarbonyl]amino]pentanoic acid (PubChem CID 99849422) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-[[(1S,2S)-2-(2-methylphenyl)cyclopropanecarbonyl]amino]pentanoic acid.
| Compound Name | 5-[[(1S,2S)-2-(2-methylphenyl)cyclopropanecarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 99849422 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5-[[(1S,2S)-2-(2-methylphenyl)cyclopropanecarbonyl]amino]pentanoic acid |
| SMILES | Cc1ccccc1[C@H]1C[C@@H]1C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C16H21NO3/c1-11-6-2-3-7-12(11)13-10-14(13)16(20)17-9-5-4-8-15(18)19/h2-3,6-7,13-14H,4-5,8-10H2,1H3,(H,17,20)(H,18,19)/t13-,14+/m1/s1 |
| InChIKey | WIULGIDTMKKTRD-KGLIPLIRSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|