C18H22F3NO3 — CID 86914458
methyl 6-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]hexanoate (PubChem CID 86914458) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is methyl 6-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 86914458 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl 6-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C1CC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO3/c1-25-16(23)9-3-2-6-10-22-17(24)14-11-13(14)12-7-4-5-8-15(12)18(19,20)21/h4-5,7-8,13-14H,2-3,6,9-11H2,1H3,(H,22,24) |
| InChIKey | RIVHPOCAGSABJH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|