C15H17N3O5 — CID 119231069
2-[3-[[4-(2-methoxyethoxy)benzoyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 119231069) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[3-[[4-(2-methoxyethoxy)benzoyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[[4-(2-methoxyethoxy)benzoyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119231069 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[3-[[4-(2-methoxyethoxy)benzoyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | COCCOc1ccc(C(=O)Nc2ccn(CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C15H17N3O5/c1-22-8-9-23-12-4-2-11(3-5-12)15(21)16-13-6-7-18(17-13)10-14(19)20/h2-7H,8-10H2,1H3,(H,19,20)(H,16,17,21) |
| InChIKey | YXMNQYRXXJCKNN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|