C20H22N2O6 — CID 119232306
2-[(4-ethoxyphenyl)methyl]-3-[(2-methyl-4-nitrobenzoyl)amino]propanoic acid (PubChem CID 119232306) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-3-[(2-methyl-4-nitrobenzoyl)amino]propanoic acid.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-3-[(2-methyl-4-nitrobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119232306 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-3-[(2-methyl-4-nitrobenzoyl)amino]propanoic acid |
| SMILES | CCOc1ccc(CC(CNC(=O)c2ccc([N+](=O)[O-])cc2C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-3-28-17-7-4-14(5-8-17)11-15(20(24)25)12-21-19(23)18-9-6-16(22(26)27)10-13(18)2/h4-10,15H,3,11-12H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | GUAGTOJDGWVPGX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|