C11H13N3O6 — CID 119232404
3-[methyl-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]propanoic acid (PubChem CID 119232404) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-[methyl-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119232404 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[methyl-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)Cn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C11H13N3O6/c1-12(5-4-11(17)18)10(16)7-13-6-8(14(19)20)2-3-9(13)15/h2-3,6H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | QHAYHKMWWBFWES-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|