C14H19N3O6 — CID 82031494
3-[methyl-[5-(5-nitro-2-oxo-1-pyridinyl)pentanoyl]amino]propanoic acid (PubChem CID 82031494) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[methyl-[5-(5-nitro-2-oxo-1-pyridinyl)pentanoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[5-(5-nitro-2-oxo-1-pyridinyl)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82031494 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-[methyl-[5-(5-nitro-2-oxo-1-pyridinyl)pentanoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)CCCCn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C14H19N3O6/c1-15(9-7-14(20)21)12(18)4-2-3-8-16-10-11(17(22)23)5-6-13(16)19/h5-6,10H,2-4,7-9H2,1H3,(H,20,21) |
| InChIKey | OBCYHWNNSBCVSR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|