C17H21ClN2O5 — CID 119232500
3-[[1-(5-chloro-2-methoxybenzoyl)pyrrolidine-2-carbonyl]-methylamino]propanoic acid (PubChem CID 119232500) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is 3-[[1-(5-chloro-2-methoxybenzoyl)pyrrolidine-2-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[1-(5-chloro-2-methoxybenzoyl)pyrrolidine-2-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119232500 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-[[1-(5-chloro-2-methoxybenzoyl)pyrrolidine-2-carbonyl]-methylamino]propanoic acid |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCCC1C(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C17H21ClN2O5/c1-19(9-7-15(21)22)17(24)13-4-3-8-20(13)16(23)12-10-11(18)5-6-14(12)25-2/h5-6,10,13H,3-4,7-9H2,1-2H3,(H,21,22) |
| InChIKey | CSEKBQHSRNOTFG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |