C21H29ClN2O3 — CID 55625468
1-(5-chloro-2-methoxybenzoyl)-N-methyl-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide (PubChem CID 55625468) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxybenzoyl)-N-methyl-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxybenzoyl)-N-methyl-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55625468 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1-(5-chloro-2-methoxybenzoyl)-N-methyl-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCCC1C(=O)N(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-14-6-9-16(10-7-14)23(2)21(26)18-5-4-12-24(18)20(25)17-13-15(22)8-11-19(17)27-3/h8,11,13-14,16,18H,4-7,9-10,12H2,1-3H3 |
| InChIKey | VBGCWXQTKQWDKW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |