C15H20N2O5 — CID 119232964
3-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]-methylamino]propanoic acid (PubChem CID 119232964) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119232964 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)C1CCCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C15H20N2O5/c1-16(9-7-13(18)19)14(20)11-5-2-3-8-17(11)15(21)12-6-4-10-22-12/h4,6,10-11H,2-3,5,7-9H2,1H3,(H,18,19) |
| InChIKey | YDBJRNLNRQJLQM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |