C16H23N3O3 — CID 119551072
1-(furan-2-carbonyl)-N-methyl-N-pyrrolidin-3-ylpiperidine-2-carboxamide (PubChem CID 119551072) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-methyl-N-pyrrolidin-3-ylpiperidine-2-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-methyl-N-pyrrolidin-3-ylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 119551072 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-methyl-N-pyrrolidin-3-ylpiperidine-2-carboxamide |
| SMILES | CN(C(=O)C1CCCCN1C(=O)c1ccco1)C1CCNC1 |
| InChI | InChI=1S/C16H23N3O3/c1-18(12-7-8-17-11-12)15(20)13-5-2-3-9-19(13)16(21)14-6-4-10-22-14/h4,6,10,12-13,17H,2-3,5,7-9,11H2,1H3 |
| InChIKey | ZXIMKSQGPCNDQN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |