C18H22N2O4S — CID 119233379
2-[[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]methyl]-3-phenylpropanoic acid (PubChem CID 119233379) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]methyl]-3-phenylpropanoic acid.
| Compound Name | 2-[[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]methyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119233379 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]methyl]-3-phenylpropanoic acid |
| SMILES | CC12CCC(=O)N1C(C(=O)NCC(Cc1ccccc1)C(=O)O)CS2 |
| InChI | InChI=1S/C18H22N2O4S/c1-18-8-7-15(21)20(18)14(11-25-18)16(22)19-10-13(17(23)24)9-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | RXGYDSYTYQEDHL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |