C19H25N3O2S — CID 35213960
(3R,7aS)-7a-methyl-5-oxo-N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 35213960) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-5-oxo-N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aS)-7a-methyl-5-oxo-N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 35213960 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R,7aS)-7a-methyl-5-oxo-N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@]12CCC(=O)N1[C@H](C(=O)NC[C@@H]1CCN(c3ccccc3)C1)CS2 |
| InChI | InChI=1S/C19H25N3O2S/c1-19-9-7-17(23)22(19)16(13-25-19)18(24)20-11-14-8-10-21(12-14)15-5-3-2-4-6-15/h2-6,14,16H,7-13H2,1H3,(H,20,24)/t14-,16-,19-/m0/s1 |
| InChIKey | VMSWFRNJECMQJZ-QOKNQOGYSA-N |
| XLogP | 2.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |