C17H21N3O3 — CID 119233443
2-benzyl-3-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid (PubChem CID 119233443) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-benzyl-3-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-benzyl-3-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119233443 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-benzyl-3-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid |
| SMILES | CC(C)n1ccc(C(=O)NCC(Cc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C17H21N3O3/c1-12(2)20-9-8-15(19-20)16(21)18-11-14(17(22)23)10-13-6-4-3-5-7-13/h3-9,12,14H,10-11H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | WVQVMGSFUTXLIP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |