C19H25N3O3 — CID 124695907
(2S)-2-benzyl-3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]propanoic acid (PubChem CID 124695907) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2S)-2-benzyl-3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-benzyl-3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 124695907 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2S)-2-benzyl-3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]propanoic acid |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)NC[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)16-11-15(22(4)21-16)17(23)20-12-14(18(24)25)10-13-8-6-5-7-9-13/h5-9,11,14H,10,12H2,1-4H3,(H,20,23)(H,24,25)/t14-/m0/s1 |
| InChIKey | FIPYHFSESNSVNY-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |