C18H20N2O5 — CID 119233820
2-benzyl-3-[[5-(oxolan-2-yl)-1,3-oxazole-4-carbonyl]amino]propanoic acid (PubChem CID 119233820) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-benzyl-3-[[5-(oxolan-2-yl)-1,3-oxazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-benzyl-3-[[5-(oxolan-2-yl)-1,3-oxazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119233820 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-benzyl-3-[[5-(oxolan-2-yl)-1,3-oxazole-4-carbonyl]amino]propanoic acid |
| SMILES | O=C(NCC(Cc1ccccc1)C(=O)O)c1ncoc1C1CCCO1 |
| InChI | InChI=1S/C18H20N2O5/c21-17(15-16(25-11-20-15)14-7-4-8-24-14)19-10-13(18(22)23)9-12-5-2-1-3-6-12/h1-3,5-6,11,13-14H,4,7-10H2,(H,19,21)(H,22,23) |
| InChIKey | NJAMIFKGEJMGAJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |