C20H22N2O4 — CID 120525108
2-benzyl-3-[(2-cyclobutyloxypyridine-4-carbonyl)amino]propanoic acid (PubChem CID 120525108) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-benzyl-3-[(2-cyclobutyloxypyridine-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-benzyl-3-[(2-cyclobutyloxypyridine-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 120525108 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-benzyl-3-[(2-cyclobutyloxypyridine-4-carbonyl)amino]propanoic acid |
| SMILES | O=C(NCC(Cc1ccccc1)C(=O)O)c1ccnc(OC2CCC2)c1 |
| InChI | InChI=1S/C20H22N2O4/c23-19(15-9-10-21-18(12-15)26-17-7-4-8-17)22-13-16(20(24)25)11-14-5-2-1-3-6-14/h1-3,5-6,9-10,12,16-17H,4,7-8,11,13H2,(H,22,23)(H,24,25) |
| InChIKey | WSDFSPVKJYDLOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |