C20H22N2O5 — CID 120528988
2-[4-[2-[(2-cyclobutyloxypyridine-4-carbonyl)amino]ethyl]phenoxy]acetic acid (PubChem CID 120528988) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[4-[2-[(2-cyclobutyloxypyridine-4-carbonyl)amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(2-cyclobutyloxypyridine-4-carbonyl)amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120528988 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[4-[2-[(2-cyclobutyloxypyridine-4-carbonyl)amino]ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CCNC(=O)c2ccnc(OC3CCC3)c2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c23-19(24)13-26-16-6-4-14(5-7-16)8-10-22-20(25)15-9-11-21-18(12-15)27-17-2-1-3-17/h4-7,9,11-12,17H,1-3,8,10,13H2,(H,22,25)(H,23,24) |
| InChIKey | ZJNZDUAZYSEQTJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |