C20H22N2O6 — CID 120538082
2-[4-[[methyl-[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]methyl]phenoxy]acetic acid (PubChem CID 120538082) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[4-[[methyl-[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[methyl-[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120538082 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[4-[[methyl-[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]methyl]phenoxy]acetic acid |
| SMILES | CN(Cc1ccc(OCC(=O)O)cc1)C(=O)c1ccnc(OC2CCOC2)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-22(11-14-2-4-16(5-3-14)27-13-19(23)24)20(25)15-6-8-21-18(10-15)28-17-7-9-26-12-17/h2-6,8,10,17H,7,9,11-13H2,1H3,(H,23,24) |
| InChIKey | KDUZTPXXTFUEHF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |