C18H20N2O3 — CID 119235511
2-[5-[[2-(cyclohexen-1-yl)acetyl]amino]indol-1-yl]acetic acid (PubChem CID 119235511) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[5-[[2-(cyclohexen-1-yl)acetyl]amino]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[[2-(cyclohexen-1-yl)acetyl]amino]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119235511 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[5-[[2-(cyclohexen-1-yl)acetyl]amino]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc2cc(NC(=O)CC3=CCCCC3)ccc21 |
| InChI | InChI=1S/C18H20N2O3/c21-17(10-13-4-2-1-3-5-13)19-15-6-7-16-14(11-15)8-9-20(16)12-18(22)23/h4,6-9,11H,1-3,5,10,12H2,(H,19,21)(H,22,23) |
| InChIKey | CGBPHEOQDOAWSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|