C14H17N3O5S — CID 119235402
2-[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]indol-1-yl]acetic acid (PubChem CID 119235402) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119235402 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]indol-1-yl]acetic acid |
| SMILES | CN(CC(=O)Nc1ccc2c(ccn2CC(=O)O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H17N3O5S/c1-16(23(2,21)22)8-13(18)15-11-3-4-12-10(7-11)5-6-17(12)9-14(19)20/h3-7H,8-9H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | VSPGSWNDZHMXCA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |