C16H18N2O5S — CID 119235539
2-[5-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]indol-1-yl]acetic acid (PubChem CID 119235539) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[5-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119235539 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[5-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc2cc(NC(=O)CC3CCS(=O)(=O)C3)ccc21 |
| InChI | InChI=1S/C16H18N2O5S/c19-15(7-11-4-6-24(22,23)10-11)17-13-1-2-14-12(8-13)3-5-18(14)9-16(20)21/h1-3,5,8,11H,4,6-7,9-10H2,(H,17,19)(H,20,21) |
| InChIKey | QNVMPIBOLFEVFW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |