C19H21ClN2O5 — CID 119235976
1-[2-[(6-chloro-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid (PubChem CID 119235976) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is 1-[2-[(6-chloro-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(6-chloro-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119235976 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[2-[(6-chloro-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid |
| SMILES | CN(CC(=O)N1CCC(C(=O)O)CC1)C(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C19H21ClN2O5/c1-21(10-17(23)22-6-4-12(5-7-22)19(25)26)18(24)14-8-13-9-15(20)2-3-16(13)27-11-14/h2-3,8-9,12H,4-7,10-11H2,1H3,(H,25,26) |
| InChIKey | PCOJVQAGRYXCFJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |