C20H24N2O6 — CID 119235627
1-[2-[(8-methoxy-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid (PubChem CID 119235627) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-[2-[(8-methoxy-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(8-methoxy-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119235627 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[2-[(8-methoxy-2H-chromene-3-carbonyl)-methylamino]acetyl]piperidine-4-carboxylic acid |
| SMILES | COc1cccc2c1OCC(C(=O)N(C)CC(=O)N1CCC(C(=O)O)CC1)=C2 |
| InChI | InChI=1S/C20H24N2O6/c1-21(11-17(23)22-8-6-13(7-9-22)20(25)26)19(24)15-10-14-4-3-5-16(27-2)18(14)28-12-15/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,25,26) |
| InChIKey | PARZFDWOUJZPMN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |