C16H21ClN2O3 — CID 119483721
[3-(aminomethyl)pyrrolidin-1-yl]-(8-methoxy-2H-chromen-3-yl)methanone;hydrochloride (PubChem CID 119483721) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-(8-methoxy-2H-chromen-3-yl)methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-(8-methoxy-2H-chromen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119483721 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-(8-methoxy-2H-chromen-3-yl)methanone;hydrochloride |
| SMILES | COc1cccc2c1OCC(C(=O)N1CCC(CN)C1)=C2.Cl |
| InChI | InChI=1S/C16H20N2O3.ClH/c1-20-14-4-2-3-12-7-13(10-21-15(12)14)16(19)18-6-5-11(8-17)9-18;/h2-4,7,11H,5-6,8-10,17H2,1H3;1H |
| InChIKey | UETJXSSHZSALCH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |