C17H22N2O3 — CID 119572685
N-(1-amino-2-cyclopropylpropan-2-yl)-8-methoxy-2H-chromene-3-carboxamide (PubChem CID 119572685) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-8-methoxy-2H-chromene-3-carboxamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-8-methoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 119572685 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-8-methoxy-2H-chromene-3-carboxamide |
| SMILES | COc1cccc2c1OCC(C(=O)NC(C)(CN)C1CC1)=C2 |
| InChI | InChI=1S/C17H22N2O3/c1-17(10-18,13-6-7-13)19-16(20)12-8-11-4-3-5-14(21-2)15(11)22-9-12/h3-5,8,13H,6-7,9-10,18H2,1-2H3,(H,19,20) |
| InChIKey | KHXGKDGLCYGJON-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |