C17H22N2O3 — CID 120601576
8-methoxy-N-(2-methylpiperidin-4-yl)-2H-chromene-3-carboxamide (PubChem CID 120601576) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 8-methoxy-N-(2-methylpiperidin-4-yl)-2H-chromene-3-carboxamide.
| Compound Name | 8-methoxy-N-(2-methylpiperidin-4-yl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 120601576 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 8-methoxy-N-(2-methylpiperidin-4-yl)-2H-chromene-3-carboxamide |
| SMILES | COc1cccc2c1OCC(C(=O)NC1CCNC(C)C1)=C2 |
| InChI | InChI=1S/C17H22N2O3/c1-11-8-14(6-7-18-11)19-17(20)13-9-12-4-3-5-15(21-2)16(12)22-10-13/h3-5,9,11,14,18H,6-8,10H2,1-2H3,(H,19,20) |
| InChIKey | WGFWSDLADFRROA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |