C19H23NO6 — CID 126772864
3-[(8-methoxy-2H-chromene-3-carbonyl)-(oxan-4-yl)amino]propanoic acid (PubChem CID 126772864) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 3-[(8-methoxy-2H-chromene-3-carbonyl)-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[(8-methoxy-2H-chromene-3-carbonyl)-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 126772864 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[(8-methoxy-2H-chromene-3-carbonyl)-(oxan-4-yl)amino]propanoic acid |
| SMILES | COc1cccc2c1OCC(C(=O)N(CCC(=O)O)C1CCOCC1)=C2 |
| InChI | InChI=1S/C19H23NO6/c1-24-16-4-2-3-13-11-14(12-26-18(13)16)19(23)20(8-5-17(21)22)15-6-9-25-10-7-15/h2-4,11,15H,5-10,12H2,1H3,(H,21,22) |
| InChIKey | GKGOKQCWMGSRRY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |