C19H22N2O5 — CID 119236286
1-[2-[methyl-(5-methyl-1-benzofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylic acid (PubChem CID 119236286) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[2-[methyl-(5-methyl-1-benzofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[methyl-(5-methyl-1-benzofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119236286 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-[methyl-(5-methyl-1-benzofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylic acid |
| SMILES | Cc1ccc2oc(C(=O)N(C)CC(=O)N3CCC(C(=O)O)CC3)cc2c1 |
| InChI | InChI=1S/C19H22N2O5/c1-12-3-4-15-14(9-12)10-16(26-15)18(23)20(2)11-17(22)21-7-5-13(6-8-21)19(24)25/h3-4,9-10,13H,5-8,11H2,1-2H3,(H,24,25) |
| InChIKey | NKUWSTJJGIVZSJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |