C18H25N3O5S — CID 119236446
1-[2-[methyl-[4-(thiophene-3-carbonylamino)butanoyl]amino]acetyl]piperidine-4-carboxylic acid (PubChem CID 119236446) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[2-[methyl-[4-(thiophene-3-carbonylamino)butanoyl]amino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[methyl-[4-(thiophene-3-carbonylamino)butanoyl]amino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119236446 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[2-[methyl-[4-(thiophene-3-carbonylamino)butanoyl]amino]acetyl]piperidine-4-carboxylic acid |
| SMILES | CN(CC(=O)N1CCC(C(=O)O)CC1)C(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-20(11-16(23)21-8-4-13(5-9-21)18(25)26)15(22)3-2-7-19-17(24)14-6-10-27-12-14/h6,10,12-13H,2-5,7-9,11H2,1H3,(H,19,24)(H,25,26) |
| InChIKey | AECLDTQCOCKNQQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|