C22H29N3O4 — CID 11923869
[2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (3aR)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxylate (PubChem CID 11923869) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (3aR)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxylate.
| Compound Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (3aR)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxylate |
|---|---|
| PubChem CID | 11923869 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (3aR)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxylate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)COC(=O)c1ccc2c(c1)NC(=O)[C@H]1CCCN21 |
| InChI | InChI=1S/C22H29N3O4/c1-13-5-3-6-16(14(13)2)23-20(26)12-29-22(28)15-8-9-18-17(11-15)24-21(27)19-7-4-10-25(18)19/h8-9,11,13-14,16,19H,3-7,10,12H2,1-2H3,(H,23,26)(H,24,27)/t13-,14-,16+,19-/m1/s1 |
| InChIKey | DANBLUUCDAPJNX-GTACMHHNSA-N |
| XLogP | 2.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |