C15H14N4O6 — CID 119240073
4-[1-(4-nitrophenyl)pyrazole-4-carbonyl]morpholine-2-carboxylic acid (PubChem CID 119240073) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is 4-[1-(4-nitrophenyl)pyrazole-4-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[1-(4-nitrophenyl)pyrazole-4-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119240073 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-[1-(4-nitrophenyl)pyrazole-4-carbonyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2)CCO1 |
| InChI | InChI=1S/C15H14N4O6/c20-14(17-5-6-25-13(9-17)15(21)22)10-7-16-18(8-10)11-1-3-12(4-2-11)19(23)24/h1-4,7-8,13H,5-6,9H2,(H,21,22) |
| InChIKey | HCYSPRNWAZOGMT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|