C17H18N4O5 — CID 122115499
(2R,3R)-2-methyl-1-[1-(4-nitrophenyl)pyrazole-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 122115499) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1-[1-(4-nitrophenyl)pyrazole-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-2-methyl-1-[1-(4-nitrophenyl)pyrazole-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122115499 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2R,3R)-2-methyl-1-[1-(4-nitrophenyl)pyrazole-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CCCN1C(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H18N4O5/c1-11-15(17(23)24)3-2-8-19(11)16(22)12-9-18-20(10-12)13-4-6-14(7-5-13)21(25)26/h4-7,9-11,15H,2-3,8H2,1H3,(H,23,24)/t11-,15-/m1/s1 |
| InChIKey | IRKMJPASSCPCHN-IAQYHMDHSA-N |
| XLogP | 2.11 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|