C19H27NO5S — CID 119240199
4-[(2-cyclohexylsulfonyl-3-methylbutanoyl)amino]-2-methylbenzoic acid (PubChem CID 119240199) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is 4-[(2-cyclohexylsulfonyl-3-methylbutanoyl)amino]-2-methylbenzoic acid.
| Compound Name | 4-[(2-cyclohexylsulfonyl-3-methylbutanoyl)amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 119240199 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[(2-cyclohexylsulfonyl-3-methylbutanoyl)amino]-2-methylbenzoic acid |
| SMILES | Cc1cc(NC(=O)C(C(C)C)S(=O)(=O)C2CCCCC2)ccc1C(=O)O |
| InChI | InChI=1S/C19H27NO5S/c1-12(2)17(26(24,25)15-7-5-4-6-8-15)18(21)20-14-9-10-16(19(22)23)13(3)11-14/h9-12,15,17H,4-8H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | OHPCINOWTVEXTD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |