C11H20O4S — CID 51889993
(2S)-2-cyclohexylsulfonyl-3-methylbutanoic acid (PubChem CID 51889993) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is (2S)-2-cyclohexylsulfonyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-cyclohexylsulfonyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 51889993 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (2S)-2-cyclohexylsulfonyl-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H20O4S/c1-8(2)10(11(12)13)16(14,15)9-6-4-3-5-7-9/h8-10H,3-7H2,1-2H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | RZCUHVRKXPGBBB-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |