C17H33ClN2O3S — CID 120599357
2-cyclohexylsulfonyl-3-methyl-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride (PubChem CID 120599357) has the molecular formula C17H33ClN2O3S and a molecular weight of 380.98 g/mol. Its IUPAC name is 2-cyclohexylsulfonyl-3-methyl-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride.
| Compound Name | 2-cyclohexylsulfonyl-3-methyl-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120599357 |
| Molecular Formula | C17H33ClN2O3S |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-cyclohexylsulfonyl-3-methyl-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride |
| SMILES | CC1CC(NC(=O)C(C(C)C)S(=O)(=O)C2CCCCC2)CCN1.Cl |
| InChI | InChI=1S/C17H32N2O3S.ClH/c1-12(2)16(23(21,22)15-7-5-4-6-8-15)17(20)19-14-9-10-18-13(3)11-14;/h12-16,18H,4-11H2,1-3H3,(H,19,20);1H |
| InChIKey | WZFPAPZTFUDLPQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |